About 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol
2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol (PubChem CID 62517611) has the molecular formula C11H22F3NO2
and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol |
| PubChem CID | 62517611 |
| Molecular Formula | C11H22F3NO2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol |
| SMILES | CCC(CC)(CO)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2/c1-3-10(4-2,8-16)15-6-5-7-17-9-11(12,13)14/h15-16H,3-9H2,1-2H3 |
| InChIKey | PFKFSNOCAOSNBS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol?
The IUPAC name of 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol (CID 62517611) is 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol.
What is the SMILES notation for 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol?
The canonical SMILES for 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol is CCC(CC)(CO)NCCCOCC(F)(F)F.
What is the InChIKey of 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol?
The InChIKey is PFKFSNOCAOSNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO2/c1-3-10(4-2,8-16)15-6-5-7-17-9-11(12,13)14/h15-16H,3-9H2,1-2H3.
What are the key properties of 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol?
2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol has a molecular weight of 257.30 g/mol, XLogP of 2.10, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[3-(2,2,2-trifluoroethoxy)propylamino]butan-1-ol is sourced from PubChem (CID 62517611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).