About [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol
[1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol (PubChem CID 62519190) has the molecular formula C10H14N6O
and a molecular weight of 234.26 g/mol. Its IUPAC name is [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol |
| PubChem CID | 62519190 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol |
| SMILES | OCC1(Nc2cncc3nnnn23)CCCC1 |
| InChI | InChI=1S/C10H14N6O/c17-7-10(3-1-2-4-10)12-8-5-11-6-9-13-14-15-16(8)9/h5-6,12,17H,1-4,7H2 |
| InChIKey | NMLQPRPBXDZSHI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol?
The IUPAC name of [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol (CID 62519190) is [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol.
What is the SMILES notation for [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol?
The canonical SMILES for [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol is OCC1(Nc2cncc3nnnn23)CCCC1.
What is the InChIKey of [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol?
The InChIKey is NMLQPRPBXDZSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O/c17-7-10(3-1-2-4-10)12-8-5-11-6-9-13-14-15-16(8)9/h5-6,12,17H,1-4,7H2.
What are the key properties of [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol?
[1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol has a molecular weight of 234.26 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(tetrazolo[1,5-a]pyrazin-5-ylamino)cyclopentyl]methanol is sourced from PubChem (CID 62519190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).