About 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine
4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine (PubChem CID 62519245) has the molecular formula C11H18N4S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine |
| PubChem CID | 62519245 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2ccn(C)n2)=N1 |
| InChI | InChI=1S/C11H18N4S/c1-4-11(5-2)8-16-10(13-11)12-9-6-7-15(3)14-9/h6-7H,4-5,8H2,1-3H3,(H,12,13,14) |
| InChIKey | XUWAKZPQMRPYHU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine?
The IUPAC name of 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine (CID 62519245) is 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine.
What is the SMILES notation for 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine?
The canonical SMILES for 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine is CCC1(CC)CSC(Nc2ccn(C)n2)=N1.
What is the InChIKey of 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine?
The InChIKey is XUWAKZPQMRPYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4S/c1-4-11(5-2)8-16-10(13-11)12-9-6-7-15(3)14-9/h6-7H,4-5,8H2,1-3H3,(H,12,13,14).
What are the key properties of 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine?
4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine has a molecular weight of 238.36 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethyl-N-(1-methylpyrazol-3-yl)-5H-1,3-thiazol-2-amine is sourced from PubChem (CID 62519245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).