C13H25N3O3 — CID 62520054
2-(carbamoylamino)-N-[1-(hydroxymethyl)cyclohexyl]-3-methylbutanamide (PubChem CID 62520054) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[1-(hydroxymethyl)cyclohexyl]-3-methylbutanamide.
| Compound Name | 2-(carbamoylamino)-N-[1-(hydroxymethyl)cyclohexyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 62520054 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-(carbamoylamino)-N-[1-(hydroxymethyl)cyclohexyl]-3-methylbutanamide |
| SMILES | CC(C)C(NC(N)=O)C(=O)NC1(CO)CCCCC1 |
| InChI | InChI=1S/C13H25N3O3/c1-9(2)10(15-12(14)19)11(18)16-13(8-17)6-4-3-5-7-13/h9-10,17H,3-8H2,1-2H3,(H,16,18)(H3,14,15,19) |
| InChIKey | SFYMFSBSEZJYET-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |