About N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide
N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 62520557) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide.
Molecular Properties
| Compound Name | N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| PubChem CID | 62520557 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(NC1(CO)CCCCC1)C1=COCCO1 |
| InChI | InChI=1S/C12H19NO4/c14-9-12(4-2-1-3-5-12)13-11(15)10-8-16-6-7-17-10/h8,14H,1-7,9H2,(H,13,15) |
| InChIKey | PYWLFJSVXKZXIX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide?
The IUPAC name of N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide (CID 62520557) is N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide.
What is the SMILES notation for N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide?
The canonical SMILES for N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide is O=C(NC1(CO)CCCCC1)C1=COCCO1.
What is the InChIKey of N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide?
The InChIKey is PYWLFJSVXKZXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4/c14-9-12(4-2-1-3-5-12)13-11(15)10-8-16-6-7-17-10/h8,14H,1-7,9H2,(H,13,15).
What are the key properties of N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide?
N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide has a molecular weight of 241.29 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(hydroxymethyl)cyclohexyl]-2,3-dihydro-1,4-dioxine-5-carboxamide is sourced from PubChem (CID 62520557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).