C11H16N2O4S — CID 62521621
N-[1-(hydroxymethyl)cyclopentyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 62521621) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopentyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[1-(hydroxymethyl)cyclopentyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62521621 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopentyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NC2(CO)CCCC2)c[nH]1 |
| InChI | InChI=1S/C11H16N2O4S/c14-8-11(5-1-2-6-11)13-18(16,17)9-3-4-10(15)12-7-9/h3-4,7,13-14H,1-2,5-6,8H2,(H,12,15) |
| InChIKey | RESIZWFWGNWSCL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |