About N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine
N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine (PubChem CID 62523033) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 62523033 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine |
| SMILES | Cc1ccc(CNCCNC2CCCC2)o1 |
| InChI | InChI=1S/C13H22N2O/c1-11-6-7-13(16-11)10-14-8-9-15-12-4-2-3-5-12/h6-7,12,14-15H,2-5,8-10H2,1H3 |
| InChIKey | VDGBGUBLNWEKEQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine (CID 62523033) is N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine is Cc1ccc(CNCCNC2CCCC2)o1.
What is the InChIKey of N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine?
The InChIKey is VDGBGUBLNWEKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-11-6-7-13(16-11)10-14-8-9-15-12-4-2-3-5-12/h6-7,12,14-15H,2-5,8-10H2,1H3.
What are the key properties of N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine?
N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine has a molecular weight of 222.33 g/mol, XLogP of 2.21, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 62523033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).