C12H15NOS — CID 62523324
N-[(5-methylfuran-2-yl)methyl]-1-thiophen-3-ylethanamine (PubChem CID 62523324) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methyl]-1-thiophen-3-ylethanamine.
| Compound Name | N-[(5-methylfuran-2-yl)methyl]-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 62523324 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methyl]-1-thiophen-3-ylethanamine |
| SMILES | Cc1ccc(CNC(C)c2ccsc2)o1 |
| InChI | InChI=1S/C12H15NOS/c1-9-3-4-12(14-9)7-13-10(2)11-5-6-15-8-11/h3-6,8,10,13H,7H2,1-2H3 |
| InChIKey | KSWAIGMJQXMJFX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |