C13H22N2O — CID 62524561
1-[(5-methylfuran-2-yl)methyl]-N-propylpyrrolidin-3-amine (PubChem CID 62524561) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-N-propylpyrrolidin-3-amine.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-N-propylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 62524561 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-N-propylpyrrolidin-3-amine |
| SMILES | CCCNC1CCN(Cc2ccc(C)o2)C1 |
| InChI | InChI=1S/C13H22N2O/c1-3-7-14-12-6-8-15(9-12)10-13-5-4-11(2)16-13/h4-5,12,14H,3,6-10H2,1-2H3 |
| InChIKey | MURHXYUIRZPAJF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |