C12H11BrN2O3 — CID 62524581
5-bromo-2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carboxylic acid (PubChem CID 62524581) has the molecular formula C12H11BrN2O3 and a molecular weight of 311.14 g/mol. Its IUPAC name is 5-bromo-2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-bromo-2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 62524581 |
| Molecular Formula | C12H11BrN2O3 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 5-bromo-2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carboxylic acid |
| SMILES | Cc1ccc(CNc2ncc(Br)cc2C(=O)O)o1 |
| InChI | InChI=1S/C12H11BrN2O3/c1-7-2-3-9(18-7)6-15-11-10(12(16)17)4-8(13)5-14-11/h2-5H,6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | FABFIZRKWUUKIU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |