About N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine
N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine (PubChem CID 62524668) has the molecular formula C14H16ClF3N2S
and a molecular weight of 336.81 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine |
| PubChem CID | 62524668 |
| Molecular Formula | C14H16ClF3N2S |
| Molecular Weight | 336.81 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2cc(C(F)(F)F)ccc2Cl)=N1 |
| InChI | InChI=1S/C14H16ClF3N2S/c1-3-13(4-2)8-21-12(20-13)19-11-7-9(14(16,17)18)5-6-10(11)15/h5-7H,3-4,8H2,1-2H3,(H,19,20) |
| InChIKey | INNGLYBCBSXMJW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.81 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine?
The IUPAC name of N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine (CID 62524668) is N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine.
What is the SMILES notation for N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine?
The canonical SMILES for N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine is CCC1(CC)CSC(Nc2cc(C(F)(F)F)ccc2Cl)=N1.
What is the InChIKey of N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine?
The InChIKey is INNGLYBCBSXMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF3N2S/c1-3-13(4-2)8-21-12(20-13)19-11-7-9(14(16,17)18)5-6-10(11)15/h5-7H,3-4,8H2,1-2H3,(H,19,20).
What are the key properties of N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine?
N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine has a molecular weight of 336.81 g/mol, XLogP of 5.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-5-(trifluoromethyl)phenyl]-4,4-diethyl-5H-1,3-thiazol-2-amine is sourced from PubChem (CID 62524668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).