About [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol
[1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol (PubChem CID 62526215) has the molecular formula C16H22BrNO3
and a molecular weight of 356.26 g/mol. Its IUPAC name is [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol |
| PubChem CID | 62526215 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol |
| SMILES | CC1CCC(CO)(NCc2cc3c(cc2Br)OCO3)CC1 |
| InChI | InChI=1S/C16H22BrNO3/c1-11-2-4-16(9-19,5-3-11)18-8-12-6-14-15(7-13(12)17)21-10-20-14/h6-7,11,18-19H,2-5,8-10H2,1H3 |
| InChIKey | JKCLGQBTGNPBRH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol?
The IUPAC name of [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol (CID 62526215) is [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol.
What is the SMILES notation for [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol?
The canonical SMILES for [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol is CC1CCC(CO)(NCc2cc3c(cc2Br)OCO3)CC1.
What is the InChIKey of [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol?
The InChIKey is JKCLGQBTGNPBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO3/c1-11-2-4-16(9-19,5-3-11)18-8-12-6-14-15(7-13(12)17)21-10-20-14/h6-7,11,18-19H,2-5,8-10H2,1H3.
What are the key properties of [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol?
[1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol has a molecular weight of 356.26 g/mol, XLogP of 3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-4-methylcyclohexyl]methanol is sourced from PubChem (CID 62526215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).