C16H21ClN2S — CID 62526952
N-(5-chloro-2-methylphenyl)-7-methyl-3-thia-1-azaspiro[4.5]dec-1-en-2-amine (PubChem CID 62526952) has the molecular formula C16H21ClN2S and a molecular weight of 308.88 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-7-methyl-3-thia-1-azaspiro[4.5]dec-1-en-2-amine.
| Compound Name | N-(5-chloro-2-methylphenyl)-7-methyl-3-thia-1-azaspiro[4.5]dec-1-en-2-amine |
|---|---|
| PubChem CID | 62526952 |
| Molecular Formula | C16H21ClN2S |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-7-methyl-3-thia-1-azaspiro[4.5]dec-1-en-2-amine |
| SMILES | Cc1ccc(Cl)cc1NC1=NC2(CCCC(C)C2)CS1 |
| InChI | InChI=1S/C16H21ClN2S/c1-11-4-3-7-16(9-11)10-20-15(19-16)18-14-8-13(17)6-5-12(14)2/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,18,19) |
| InChIKey | SPXLKGIWFTUMOW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |