C15H20F2N2O2 — CID 62527087
2-amino-4,5-difluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide (PubChem CID 62527087) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-amino-4,5-difluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide.
| Compound Name | 2-amino-4,5-difluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 62527087 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-amino-4,5-difluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide |
| SMILES | CC1CCC(CO)(NC(=O)c2cc(F)c(F)cc2N)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-9-2-4-15(8-20,5-3-9)19-14(21)10-6-11(16)12(17)7-13(10)18/h6-7,9,20H,2-5,8,18H2,1H3,(H,19,21) |
| InChIKey | XBDXESMYZUACKU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|