C15H25NO2 — CID 62527351
2-cyclopent-2-en-1-yl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]acetamide (PubChem CID 62527351) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 62527351 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]acetamide |
| SMILES | CC1CCC(CO)(NC(=O)CC2C=CCC2)CC1 |
| InChI | InChI=1S/C15H25NO2/c1-12-6-8-15(11-17,9-7-12)16-14(18)10-13-4-2-3-5-13/h2,4,12-13,17H,3,5-11H2,1H3,(H,16,18) |
| InChIKey | FPIUASXYUYUXHP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|