C15H19Cl2NO2 — CID 62527722
2,5-dichloro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzamide (PubChem CID 62527722) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 62527722 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2,5-dichloro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzamide |
| SMILES | CC1CCCC(CO)(NC(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-10-3-2-6-15(8-10,9-19)18-14(20)12-7-11(16)4-5-13(12)17/h4-5,7,10,19H,2-3,6,8-9H2,1H3,(H,18,20) |
| InChIKey | JTCCQNKBTLQVCJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |