About N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine
N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine (PubChem CID 62528249) has the molecular formula C17H35NO2S
and a molecular weight of 317.54 g/mol. Its IUPAC name is N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine |
| PubChem CID | 62528249 |
| Molecular Formula | C17H35NO2S |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine |
| SMILES | CCCCCCCC(CNC(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H35NO2S/c1-5-6-7-8-9-10-15(13-18-17(2,3)4)16-11-12-21(19,20)14-16/h15-16,18H,5-14H2,1-4H3 |
| InChIKey | VPGDSDDEQXILCE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine?
The IUPAC name of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine (CID 62528249) is N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine.
What is the SMILES notation for N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine?
The canonical SMILES for N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine is CCCCCCCC(CNC(C)(C)C)C1CCS(=O)(=O)C1.
What is the InChIKey of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine?
The InChIKey is VPGDSDDEQXILCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2S/c1-5-6-7-8-9-10-15(13-18-17(2,3)4)16-11-12-21(19,20)14-16/h15-16,18H,5-14H2,1-4H3.
What are the key properties of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine?
N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine has a molecular weight of 317.54 g/mol, XLogP of 3.79, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(1,1-dioxothiolan-3-yl)nonan-1-amine is sourced from PubChem (CID 62528249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).