C13H19BrFN — CID 62528631
N-[3-(2-bromo-4-fluorophenyl)propyl]-2-methylpropan-2-amine (PubChem CID 62528631) has the molecular formula C13H19BrFN and a molecular weight of 288.20 g/mol. Its IUPAC name is N-[3-(2-bromo-4-fluorophenyl)propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-(2-bromo-4-fluorophenyl)propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62528631 |
| Molecular Formula | C13H19BrFN |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-[3-(2-bromo-4-fluorophenyl)propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCCc1ccc(F)cc1Br |
| InChI | InChI=1S/C13H19BrFN/c1-13(2,3)16-8-4-5-10-6-7-11(15)9-12(10)14/h6-7,9,16H,4-5,8H2,1-3H3 |
| InChIKey | BOSVKVGELKDKAL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|