C15H22BrNO2S — CID 62528849
3-(4-bromophenyl)-2-(1,1-dioxothiolan-3-yl)-N-ethylpropan-1-amine (PubChem CID 62528849) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(1,1-dioxothiolan-3-yl)-N-ethylpropan-1-amine.
| Compound Name | 3-(4-bromophenyl)-2-(1,1-dioxothiolan-3-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 62528849 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-(4-bromophenyl)-2-(1,1-dioxothiolan-3-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCC(Cc1ccc(Br)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22BrNO2S/c1-2-17-10-14(13-7-8-20(18,19)11-13)9-12-3-5-15(16)6-4-12/h3-6,13-14,17H,2,7-11H2,1H3 |
| InChIKey | ZOYVGJPGZRWCLQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |