C14H15BrClNS — CID 62529611
2-[(4-bromothiophen-2-yl)methyl]-3-(2-chlorophenyl)propan-1-amine (PubChem CID 62529611) has the molecular formula C14H15BrClNS and a molecular weight of 344.70 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-3-(2-chlorophenyl)propan-1-amine.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-3-(2-chlorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 62529611 |
| Molecular Formula | C14H15BrClNS |
| Molecular Weight | 344.70 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-3-(2-chlorophenyl)propan-1-amine |
| SMILES | NCC(Cc1cc(Br)cs1)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H15BrClNS/c15-12-7-13(18-9-12)6-10(8-17)5-11-3-1-2-4-14(11)16/h1-4,7,9-10H,5-6,8,17H2 |
| InChIKey | HWWPDSVKPUHZIH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |