C12H22F3NO3S — CID 62530036
2-(1,1-dioxothiolan-3-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 62530036) has the molecular formula C12H22F3NO3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 62530036 |
| Molecular Formula | C12H22F3NO3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-ethyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | CCNCC(CCOCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22F3NO3S/c1-2-16-7-10(3-5-19-9-12(13,14)15)11-4-6-20(17,18)8-11/h10-11,16H,2-9H2,1H3 |
| InChIKey | LTXQSADOOVGBFO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|