C13H24F3NO3S — CID 62530640
2-(1,1-dioxothiolan-3-yl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 62530640) has the molecular formula C13H24F3NO3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 62530640 |
| Molecular Formula | C13H24F3NO3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | CCCNCC(CCOCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24F3NO3S/c1-2-5-17-8-11(3-6-20-10-13(14,15)16)12-4-7-21(18,19)9-12/h11-12,17H,2-10H2,1H3 |
| InChIKey | BEAGLQIETNOEON-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|