C13H12ClF2N3O3 — CID 625309
ethyl 5-amino-1-[4-[chloro(difluoro)methoxy]phenyl]pyrazole-4-carboxylate (PubChem CID 625309) has the molecular formula C13H12ClF2N3O3 and a molecular weight of 331.71 g/mol. Its IUPAC name is ethyl 5-amino-1-[4-[chloro(difluoro)methoxy]phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[4-[chloro(difluoro)methoxy]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 625309 |
| Molecular Formula | C13H12ClF2N3O3 |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | ethyl 5-amino-1-[4-[chloro(difluoro)methoxy]phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(OC(F)(F)Cl)cc2)c1N |
| InChI | InChI=1S/C13H12ClF2N3O3/c1-2-21-12(20)10-7-18-19(11(10)17)8-3-5-9(6-4-8)22-13(14,15)16/h3-7H,2,17H2,1H3 |
| InChIKey | MYARUKRSKKDEHE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|