C11H20F3NO3S — CID 62531255
2-(1,1-dioxothiolan-3-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 62531255) has the molecular formula C11H20F3NO3S and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 62531255 |
| Molecular Formula | C11H20F3NO3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | CNCC(CCOCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20F3NO3S/c1-15-6-9(2-4-18-8-11(12,13)14)10-3-5-19(16,17)7-10/h9-10,15H,2-8H2,1H3 |
| InChIKey | MVNFIUVQLRNIPE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|