C12H11F2N5S — CID 62532031
4,5-difluoro-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 62532031) has the molecular formula C12H11F2N5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4,5-difluoro-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 4,5-difluoro-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 62532031 |
| Molecular Formula | C12H11F2N5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4,5-difluoro-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | CC(c1nncn1C)n1c(=S)[nH]c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C12H11F2N5S/c1-6(11-17-15-5-18(11)2)19-10-8(16-12(19)20)4-3-7(13)9(10)14/h3-6H,1-2H3,(H,16,20) |
| InChIKey | JWEBOTLERBORBN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|