About 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid
2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid (PubChem CID 62532208) has the molecular formula C13H12F2N2O2S
and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid |
| PubChem CID | 62532208 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2ccc(F)c(F)c2n1C1CCC1 |
| InChI | InChI=1S/C13H12F2N2O2S/c14-8-4-5-9-12(11(8)15)17(7-2-1-3-7)13(16-9)20-6-10(18)19/h4-5,7H,1-3,6H2,(H,18,19) |
| InChIKey | GZWVZYQGRXVGOA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid?
The IUPAC name of 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid (CID 62532208) is 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid?
The canonical SMILES for 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid is O=C(O)CSc1nc2ccc(F)c(F)c2n1C1CCC1.
What is the InChIKey of 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid?
The InChIKey is GZWVZYQGRXVGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2O2S/c14-8-4-5-9-12(11(8)15)17(7-2-1-3-7)13(16-9)20-6-10(18)19/h4-5,7H,1-3,6H2,(H,18,19).
What are the key properties of 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid?
2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid has a molecular weight of 298.31 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclobutyl-6,7-difluorobenzimidazol-2-yl)sulfanylacetic acid is sourced from PubChem (CID 62532208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).