C11H8F2N4OS — CID 62532707
4,5-difluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 62532707) has the molecular formula C11H8F2N4OS and a molecular weight of 282.28 g/mol. Its IUPAC name is 4,5-difluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 4,5-difluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 62532707 |
| Molecular Formula | C11H8F2N4OS |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4,5-difluoro-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1noc(Cn2c(=S)[nH]c3ccc(F)c(F)c32)n1 |
| InChI | InChI=1S/C11H8F2N4OS/c1-5-14-8(18-16-5)4-17-10-7(15-11(17)19)3-2-6(12)9(10)13/h2-3H,4H2,1H3,(H,15,19) |
| InChIKey | DFGPEAKSMVDQPS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|