About 3-(6-amino-2,3-difluoroanilino)propan-1-ol
3-(6-amino-2,3-difluoroanilino)propan-1-ol (PubChem CID 62532991) has the molecular formula C9H12F2N2O
and a molecular weight of 202.20 g/mol. Its IUPAC name is 3-(6-amino-2,3-difluoroanilino)propan-1-ol.
Molecular Properties
| Compound Name | 3-(6-amino-2,3-difluoroanilino)propan-1-ol |
| PubChem CID | 62532991 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-(6-amino-2,3-difluoroanilino)propan-1-ol |
| SMILES | Nc1ccc(F)c(F)c1NCCCO |
| InChI | InChI=1S/C9H12F2N2O/c10-6-2-3-7(12)9(8(6)11)13-4-1-5-14/h2-3,13-14H,1,4-5,12H2 |
| InChIKey | JXVLPDINBACXDM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-amino-2,3-difluoroanilino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-amino-2,3-difluoroanilino)propan-1-ol?
The IUPAC name of 3-(6-amino-2,3-difluoroanilino)propan-1-ol (CID 62532991) is 3-(6-amino-2,3-difluoroanilino)propan-1-ol.
What is the SMILES notation for 3-(6-amino-2,3-difluoroanilino)propan-1-ol?
The canonical SMILES for 3-(6-amino-2,3-difluoroanilino)propan-1-ol is Nc1ccc(F)c(F)c1NCCCO.
What is the InChIKey of 3-(6-amino-2,3-difluoroanilino)propan-1-ol?
The InChIKey is JXVLPDINBACXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O/c10-6-2-3-7(12)9(8(6)11)13-4-1-5-14/h2-3,13-14H,1,4-5,12H2.
What are the key properties of 3-(6-amino-2,3-difluoroanilino)propan-1-ol?
3-(6-amino-2,3-difluoroanilino)propan-1-ol has a molecular weight of 202.20 g/mol, XLogP of 1.34, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-amino-2,3-difluoroanilino)propan-1-ol is sourced from PubChem (CID 62532991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).