About 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline
2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline (PubChem CID 62533930) has the molecular formula C14H19F2NO
and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline.
Molecular Properties
| Compound Name | 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline |
| PubChem CID | 62533930 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline |
| SMILES | CCC1CCCCC1Oc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C14H19F2NO/c1-2-9-5-3-4-6-12(9)18-14-11(17)8-7-10(15)13(14)16/h7-9,12H,2-6,17H2,1H3 |
| InChIKey | MMLBGNYMSYIFJL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline?
The IUPAC name of 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline (CID 62533930) is 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline.
What is the SMILES notation for 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline?
The canonical SMILES for 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline is CCC1CCCCC1Oc1c(N)ccc(F)c1F.
What is the InChIKey of 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline?
The InChIKey is MMLBGNYMSYIFJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO/c1-2-9-5-3-4-6-12(9)18-14-11(17)8-7-10(15)13(14)16/h7-9,12H,2-6,17H2,1H3.
What are the key properties of 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline?
2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline has a molecular weight of 255.31 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylcyclohexyl)oxy-3,4-difluoroaniline is sourced from PubChem (CID 62533930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).