C17H10N4O — CID 625345
13-phenyl-12-oxa-1,8,10,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,13,15-heptaene (PubChem CID 625345) has the molecular formula C17H10N4O and a molecular weight of 286.29 g/mol. Its IUPAC name is 13-phenyl-12-oxa-1,8,10,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,13,15-heptaene.
| Compound Name | 13-phenyl-12-oxa-1,8,10,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,13,15-heptaene |
|---|---|
| PubChem CID | 625345 |
| Molecular Formula | C17H10N4O |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 13-phenyl-12-oxa-1,8,10,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,13,15-heptaene |
| SMILES | c1ccc(-c2cc3nn4c(nc5ccccc54)nc3o2)cc1 |
| InChI | InChI=1S/C17H10N4O/c1-2-6-11(7-3-1)15-10-13-16(22-15)19-17-18-12-8-4-5-9-14(12)21(17)20-13/h1-10H |
| InChIKey | GWUIPQXLARGCRR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |