About 1,8-dibromonaphthalene
1,8-dibromonaphthalene (PubChem CID 625356) has the molecular formula C10H6Br2
and a molecular weight of 285.97 g/mol. Its IUPAC name is 1,8-dibromonaphthalene.
Molecular Properties
| Compound Name | 1,8-dibromonaphthalene |
| PubChem CID | 625356 |
| Molecular Formula | C10H6Br2 |
| Molecular Weight | 285.97 g/mol |
| Exact Mass | 283.88 |
| IUPAC Name | 1,8-dibromonaphthalene |
| SMILES | Brc1cccc2cccc(Br)c12 |
| InChI | InChI=1S/C10H6Br2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H |
| InChIKey | DLXBGTIGAIESIG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.97 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,8-dibromonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dibromonaphthalene?
The IUPAC name of 1,8-dibromonaphthalene (CID 625356) is 1,8-dibromonaphthalene.
What is the SMILES notation for 1,8-dibromonaphthalene?
The canonical SMILES for 1,8-dibromonaphthalene is Brc1cccc2cccc(Br)c12.
What is the InChIKey of 1,8-dibromonaphthalene?
The InChIKey is DLXBGTIGAIESIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Br2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H.
What are the key properties of 1,8-dibromonaphthalene?
1,8-dibromonaphthalene has a molecular weight of 285.97 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dibromonaphthalene is sourced from PubChem (CID 625356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).