C13H16BrClN2O — CID 62535972
(5-bromo-2-chlorophenyl)-[3-(methylamino)piperidin-1-yl]methanone (PubChem CID 62535972) has the molecular formula C13H16BrClN2O and a molecular weight of 331.64 g/mol. Its IUPAC name is (5-bromo-2-chlorophenyl)-[3-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (5-bromo-2-chlorophenyl)-[3-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 62535972 |
| Molecular Formula | C13H16BrClN2O |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (5-bromo-2-chlorophenyl)-[3-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCCN(C(=O)c2cc(Br)ccc2Cl)C1 |
| InChI | InChI=1S/C13H16BrClN2O/c1-16-10-3-2-6-17(8-10)13(18)11-7-9(14)4-5-12(11)15/h4-5,7,10,16H,2-3,6,8H2,1H3 |
| InChIKey | ZETOAWJBAJFYQD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |