About 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid
3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid (PubChem CID 62536251) has the molecular formula C7H12F3NO3
and a molecular weight of 215.17 g/mol. Its IUPAC name is 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid.
Molecular Properties
| Compound Name | 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid |
| PubChem CID | 62536251 |
| Molecular Formula | C7H12F3NO3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid |
| SMILES | COCC(C)(NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H12F3NO3/c1-6(4-14-2,5(12)13)11-3-7(8,9)10/h11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | UUWAEKQGJUWISX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid?
The IUPAC name of 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid (CID 62536251) is 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid.
What is the SMILES notation for 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid?
The canonical SMILES for 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid is COCC(C)(NCC(F)(F)F)C(=O)O.
What is the InChIKey of 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid?
The InChIKey is UUWAEKQGJUWISX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO3/c1-6(4-14-2,5(12)13)11-3-7(8,9)10/h11H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid?
3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid has a molecular weight of 215.17 g/mol, XLogP of 0.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-methyl-2-(2,2,2-trifluoroethylamino)propanoic acid is sourced from PubChem (CID 62536251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).