C11H14Cl2N2 — CID 62537230
1-(3,4-dichlorophenyl)piperidin-3-amine (PubChem CID 62537230) has the molecular formula C11H14Cl2N2 and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)piperidin-3-amine.
| Compound Name | 1-(3,4-dichlorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 62537230 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)piperidin-3-amine |
| SMILES | NC1CCCN(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H14Cl2N2/c12-10-4-3-9(6-11(10)13)15-5-1-2-8(14)7-15/h3-4,6,8H,1-2,5,7,14H2 |
| InChIKey | NJLRPQXEJMDNFX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |