C17H18BrNO — CID 62537978
N-[(4-bromophenyl)methyl]-2-(3,4-dimethylphenyl)acetamide (PubChem CID 62537978) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-2-(3,4-dimethylphenyl)acetamide.
| Compound Name | N-[(4-bromophenyl)methyl]-2-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 62537978 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-2-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NCc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C17H18BrNO/c1-12-3-4-15(9-13(12)2)10-17(20)19-11-14-5-7-16(18)8-6-14/h3-9H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | HTVLEFJFDQOKQW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |