2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid

C14H19NO3 — CID 62538005

IUPAC2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid
SMILESCCN(CC(=O)O)C(=O)Cc1cc(C)ccc1C
InChIInChI=1S/C14H19NO3/c1-4-15(9-14(17)18)13(16)8-12-7-10(2)5-6-11(12)3/h5-7H,4,8-9H2,1-3H3,(H,17,18)
InChIKeyQPGNIMDOXCMXAD-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.78
Rot. Bonds5

About 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid

2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid (PubChem CID 62538005) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid.

Molecular Properties

Compound Name2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid
PubChem CID62538005
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Name2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid
SMILESCCN(CC(=O)O)C(=O)Cc1cc(C)ccc1C
InChIInChI=1S/C14H19NO3/c1-4-15(9-14(17)18)13(16)8-12-7-10(2)5-6-11(12)3/h5-7H,4,8-9H2,1-3H3,(H,17,18)
InChIKeyQPGNIMDOXCMXAD-UHFFFAOYSA-N
XLogP1.78
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid?
The IUPAC name of 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid (CID 62538005) is 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid.
What is the SMILES notation for 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid?
The canonical SMILES for 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid is CCN(CC(=O)O)C(=O)Cc1cc(C)ccc1C.
What is the InChIKey of 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid?
The InChIKey is QPGNIMDOXCMXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-4-15(9-14(17)18)13(16)8-12-7-10(2)5-6-11(12)3/h5-7H,4,8-9H2,1-3H3,(H,17,18).
What are the key properties of 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid?
2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid has a molecular weight of 249.31 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,5-dimethylphenyl)acetyl]-ethylamino]acetic acid is sourced from PubChem (CID 62538005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).