C26H26O5 — CID 625387
dimethyl 2-(5-benzhydrylidene-3-oxo-1,2,3a,4,6,6a-hexahydropentalen-1-yl)propanedioate (PubChem CID 625387) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is dimethyl 2-(5-benzhydrylidene-3-oxo-1,2,3a,4,6,6a-hexahydropentalen-1-yl)propanedioate.
| Compound Name | dimethyl 2-(5-benzhydrylidene-3-oxo-1,2,3a,4,6,6a-hexahydropentalen-1-yl)propanedioate |
|---|---|
| PubChem CID | 625387 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | dimethyl 2-(5-benzhydrylidene-3-oxo-1,2,3a,4,6,6a-hexahydropentalen-1-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1CC(=O)C2CC(=C(c3ccccc3)c3ccccc3)CC21 |
| InChI | InChI=1S/C26H26O5/c1-30-25(28)24(26(29)31-2)21-15-22(27)20-14-18(13-19(20)21)23(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,19-21,24H,13-15H2,1-2H3 |
| InChIKey | JAUZDDXXYKBWIJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|