C14H17BrN2 — CID 62539146
2-[2-bromo-3-(3,4-dimethylphenyl)propyl]-1H-imidazole (PubChem CID 62539146) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 2-[2-bromo-3-(3,4-dimethylphenyl)propyl]-1H-imidazole.
| Compound Name | 2-[2-bromo-3-(3,4-dimethylphenyl)propyl]-1H-imidazole |
|---|---|
| PubChem CID | 62539146 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[2-bromo-3-(3,4-dimethylphenyl)propyl]-1H-imidazole |
| SMILES | Cc1ccc(CC(Br)Cc2ncc[nH]2)cc1C |
| InChI | InChI=1S/C14H17BrN2/c1-10-3-4-12(7-11(10)2)8-13(15)9-14-16-5-6-17-14/h3-7,13H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | XOEGWFNYALHFOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|