C17H17N3 — CID 62539638
5-[(3,4-dimethylphenyl)methyl]-3-phenyl-1H-1,2,4-triazole (PubChem CID 62539638) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)methyl]-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-[(3,4-dimethylphenyl)methyl]-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62539638 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)methyl]-3-phenyl-1H-1,2,4-triazole |
| SMILES | Cc1ccc(Cc2nc(-c3ccccc3)n[nH]2)cc1C |
| InChI | InChI=1S/C17H17N3/c1-12-8-9-14(10-13(12)2)11-16-18-17(20-19-16)15-6-4-3-5-7-15/h3-10H,11H2,1-2H3,(H,18,19,20) |
| InChIKey | DLQUZAYKKIAVFP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |