C14H19F2NO3 — CID 62539749
ethyl 2-(2,6-difluorophenyl)-2-(2-methoxyethylamino)propanoate (PubChem CID 62539749) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 2-(2,6-difluorophenyl)-2-(2-methoxyethylamino)propanoate.
| Compound Name | ethyl 2-(2,6-difluorophenyl)-2-(2-methoxyethylamino)propanoate |
|---|---|
| PubChem CID | 62539749 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 2-(2,6-difluorophenyl)-2-(2-methoxyethylamino)propanoate |
| SMILES | CCOC(=O)C(C)(NCCOC)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO3/c1-4-20-13(18)14(2,17-8-9-19-3)12-10(15)6-5-7-11(12)16/h5-7,17H,4,8-9H2,1-3H3 |
| InChIKey | FKRSTFOPMLQVEA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|