C12H14ClN3O3 — CID 62539858
2-chloro-5-nitro-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 62539858) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-5-nitro-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 62539858 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-chloro-5-nitro-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCN1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C12H14ClN3O3/c13-11-4-3-9(16(18)19)6-10(11)12(17)15-7-8-2-1-5-14-8/h3-4,6,8,14H,1-2,5,7H2,(H,15,17) |
| InChIKey | YTVTZMLCMUHEJB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|