C32H66B2Si4Sn — CID 625425
[2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-stannaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane (PubChem CID 625425) has the molecular formula C32H66B2Si4Sn and a molecular weight of 703.56 g/mol. Its IUPAC name is [2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-stannaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane.
| Compound Name | [2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-stannaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 625425 |
| Molecular Formula | C32H66B2Si4Sn |
| Molecular Weight | 703.56 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | [2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-stannaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane |
| SMILES | CCB(CC)C1=C([Si](C)(C)C)[Sn]2(C([Si](C)(C)C)=C1CC)C([Si](C)(C)C)=C(CC)C(B(CC)CC)=C2[Si](C)(C)C |
| InChI | InChI=1S/2C16H33BSi2.Sn/c2*1-10-15(13-18(4,5)6)16(14-19(7,8)9)17(11-2)12-3;/h2*10-12H2,1-9H3; |
| InChIKey | FMCFNKLDAJYULY-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.56 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|