C11H17N3O4 — CID 62542610
4-(3-oxo-3-piperazin-1-ylpropyl)morpholine-3,5-dione (PubChem CID 62542610) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(3-oxo-3-piperazin-1-ylpropyl)morpholine-3,5-dione.
| Compound Name | 4-(3-oxo-3-piperazin-1-ylpropyl)morpholine-3,5-dione |
|---|---|
| PubChem CID | 62542610 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-(3-oxo-3-piperazin-1-ylpropyl)morpholine-3,5-dione |
| SMILES | O=C(CCN1C(=O)COCC1=O)N1CCNCC1 |
| InChI | InChI=1S/C11H17N3O4/c15-9(13-5-2-12-3-6-13)1-4-14-10(16)7-18-8-11(14)17/h12H,1-8H2 |
| InChIKey | NAGBYHMKGZNWIF-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|