C13H26N4OS — CID 62545536
N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-[methyl-(1-methylpiperidin-3-yl)amino]acetamide (PubChem CID 62545536) has the molecular formula C13H26N4OS and a molecular weight of 286.44 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-[methyl-(1-methylpiperidin-3-yl)amino]acetamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-[methyl-(1-methylpiperidin-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 62545536 |
| Molecular Formula | C13H26N4OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-[methyl-(1-methylpiperidin-3-yl)amino]acetamide |
| SMILES | CN1CCCC(N(C)CC(=O)N(C)CCC(N)=S)C1 |
| InChI | InChI=1S/C13H26N4OS/c1-15-7-4-5-11(9-15)17(3)10-13(18)16(2)8-6-12(14)19/h11H,4-10H2,1-3H3,(H2,14,19) |
| InChIKey | KVJPHAWJHQGKSS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|