C15H19ClN4 — CID 62545795
2-chloro-N-methyl-N-(1-methylpiperidin-3-yl)quinazolin-4-amine (PubChem CID 62545795) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(1-methylpiperidin-3-yl)quinazolin-4-amine.
| Compound Name | 2-chloro-N-methyl-N-(1-methylpiperidin-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 62545795 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-chloro-N-methyl-N-(1-methylpiperidin-3-yl)quinazolin-4-amine |
| SMILES | CN1CCCC(N(C)c2nc(Cl)nc3ccccc23)C1 |
| InChI | InChI=1S/C15H19ClN4/c1-19-9-5-6-11(10-19)20(2)14-12-7-3-4-8-13(12)17-15(16)18-14/h3-4,7-8,11H,5-6,9-10H2,1-2H3 |
| InChIKey | PUQPAFQXLZRMTQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |