About 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine
4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine (PubChem CID 62546048) has the molecular formula C13H29N3O
and a molecular weight of 243.39 g/mol. Its IUPAC name is 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine.
Molecular Properties
| Compound Name | 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine |
| PubChem CID | 62546048 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine |
| SMILES | COCCC(C)(CN)N(C)C1CCCN(C)C1 |
| InChI | InChI=1S/C13H29N3O/c1-13(11-14,7-9-17-4)16(3)12-6-5-8-15(2)10-12/h12H,5-11,14H2,1-4H3 |
| InChIKey | OMFKNYDPBLTDIG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine?
The IUPAC name of 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine (CID 62546048) is 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine.
What is the SMILES notation for 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine?
The canonical SMILES for 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine is COCCC(C)(CN)N(C)C1CCCN(C)C1.
What is the InChIKey of 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine?
The InChIKey is OMFKNYDPBLTDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3O/c1-13(11-14,7-9-17-4)16(3)12-6-5-8-15(2)10-12/h12H,5-11,14H2,1-4H3.
What are the key properties of 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine?
4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine has a molecular weight of 243.39 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-N,2-dimethyl-2-N-(1-methylpiperidin-3-yl)butane-1,2-diamine is sourced from PubChem (CID 62546048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).