C15H22N4S — CID 62546220
5-N,2-dimethyl-5-N-(1-methylpiperidin-3-yl)-1,3-benzothiazole-5,6-diamine (PubChem CID 62546220) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 5-N,2-dimethyl-5-N-(1-methylpiperidin-3-yl)-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N,2-dimethyl-5-N-(1-methylpiperidin-3-yl)-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 62546220 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-N,2-dimethyl-5-N-(1-methylpiperidin-3-yl)-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(N(C)C3CCCN(C)C3)c(N)cc2s1 |
| InChI | InChI=1S/C15H22N4S/c1-10-17-13-8-14(12(16)7-15(13)20-10)19(3)11-5-4-6-18(2)9-11/h7-8,11H,4-6,9,16H2,1-3H3 |
| InChIKey | BLSNRQRIJNBQPF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|