About (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine
(Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine (PubChem CID 6254699) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine.
Molecular Properties
| Compound Name | (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine |
| PubChem CID | 6254699 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine |
| SMILES | N/N=C1/c2ccccc2-n2cccc21 |
| InChI | InChI=1S/C11H9N3/c12-13-11-8-4-1-2-5-9(8)14-7-3-6-10(11)14/h1-7H,12H2/b13-11- |
| InChIKey | WKHKXHWSSPTGFL-QBFSEMIESA-N |
| XLogP | 1.50 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine?
The IUPAC name of (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine (CID 6254699) is (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine.
What is the SMILES notation for (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine?
The canonical SMILES for (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine is N/N=C1/c2ccccc2-n2cccc21.
What is the InChIKey of (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine?
The InChIKey is WKHKXHWSSPTGFL-QBFSEMIESA-N. The full InChI is InChI=1S/C11H9N3/c12-13-11-8-4-1-2-5-9(8)14-7-3-6-10(11)14/h1-7H,12H2/b13-11-.
What are the key properties of (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine?
(Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine has a molecular weight of 183.21 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-pyrrolo[1,2-a]indol-4-ylidenehydrazine is sourced from PubChem (CID 6254699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).