About 5-propyl-1,3-benzoxazol-2-amine
5-propyl-1,3-benzoxazol-2-amine (PubChem CID 62548389) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-propyl-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-propyl-1,3-benzoxazol-2-amine |
| PubChem CID | 62548389 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-propyl-1,3-benzoxazol-2-amine |
| SMILES | CCCc1ccc2oc(N)nc2c1 |
| InChI | InChI=1S/C10H12N2O/c1-2-3-7-4-5-9-8(6-7)12-10(11)13-9/h4-6H,2-3H2,1H3,(H2,11,12) |
| InChIKey | JSWJQBTZOKANPU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propyl-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-1,3-benzoxazol-2-amine?
The IUPAC name of 5-propyl-1,3-benzoxazol-2-amine (CID 62548389) is 5-propyl-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-propyl-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-propyl-1,3-benzoxazol-2-amine is CCCc1ccc2oc(N)nc2c1.
What is the InChIKey of 5-propyl-1,3-benzoxazol-2-amine?
The InChIKey is JSWJQBTZOKANPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-3-7-4-5-9-8(6-7)12-10(11)13-9/h4-6H,2-3H2,1H3,(H2,11,12).
What are the key properties of 5-propyl-1,3-benzoxazol-2-amine?
5-propyl-1,3-benzoxazol-2-amine has a molecular weight of 176.22 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1,3-benzoxazol-2-amine is sourced from PubChem (CID 62548389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).