About (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole
(2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole (PubChem CID 6254859) has the molecular formula C14H13Cl2N3O4
and a molecular weight of 358.18 g/mol. Its IUPAC name is (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole.
Molecular Properties
| Compound Name | (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole |
| PubChem CID | 6254859 |
| Molecular Formula | C14H13Cl2N3O4 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole |
| SMILES | O=[N+]([O-])C(=C1\Nc2ccccc2O1)/C(Cl)=C(\Cl)N1CCOCC1 |
| InChI | InChI=1S/C14H13Cl2N3O4/c15-11(13(16)18-5-7-22-8-6-18)12(19(20)21)14-17-9-3-1-2-4-10(9)23-14/h1-4,17H,5-8H2/b13-11-,14-12+ |
| InChIKey | MYNIVKDMRUSPSY-HEEUSZRZSA-N |
| XLogP | 2.92 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole?
The IUPAC name of (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole (CID 6254859) is (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole.
What is the SMILES notation for (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole?
The canonical SMILES for (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole is O=[N+]([O-])C(=C1\Nc2ccccc2O1)/C(Cl)=C(\Cl)N1CCOCC1.
What is the InChIKey of (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole?
The InChIKey is MYNIVKDMRUSPSY-HEEUSZRZSA-N. The full InChI is InChI=1S/C14H13Cl2N3O4/c15-11(13(16)18-5-7-22-8-6-18)12(19(20)21)14-17-9-3-1-2-4-10(9)23-14/h1-4,17H,5-8H2/b13-11-,14-12+.
What are the key properties of (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole?
(2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole has a molecular weight of 358.18 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-2,3-dichloro-3-morpholin-4-yl-1-nitroprop-2-enylidene]-3H-1,3-benzoxazole is sourced from PubChem (CID 6254859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).